C15H10N2O6 — CID 10245095
2-[4-(6-nitro-1,3-benzoxazol-2-yl)phenoxy]acetic acid (PubChem CID 10245095) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is 2-[4-(6-nitro-1,3-benzoxazol-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(6-nitro-1,3-benzoxazol-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 10245095 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[4-(6-nitro-1,3-benzoxazol-2-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2nc3ccc([N+](=O)[O-])cc3o2)cc1 |
| InChI | InChI=1S/C15H10N2O6/c18-14(19)8-22-11-4-1-9(2-5-11)15-16-12-6-3-10(17(20)21)7-13(12)23-15/h1-7H,8H2,(H,18,19) |
| InChIKey | CIMCVWQVHVDRBQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|