C10H5N3O3S — CID 71662777
6-nitro-2-(1,3-thiazol-5-yl)-1,3-benzoxazole (PubChem CID 71662777) has the molecular formula C10H5N3O3S and a molecular weight of 247.24 g/mol. Its IUPAC name is 6-nitro-2-(1,3-thiazol-5-yl)-1,3-benzoxazole.
| Compound Name | 6-nitro-2-(1,3-thiazol-5-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 71662777 |
| Molecular Formula | C10H5N3O3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 6-nitro-2-(1,3-thiazol-5-yl)-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3cncs3)oc2c1 |
| InChI | InChI=1S/C10H5N3O3S/c14-13(15)6-1-2-7-8(3-6)16-10(12-7)9-4-11-5-17-9/h1-5H |
| InChIKey | FSRQNNAAWZUJOA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|