C22H16N4O7 — CID 3116207
N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-2,4-dinitrobenzamide (PubChem CID 3116207) has the molecular formula C22H16N4O7 and a molecular weight of 448.39 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-2,4-dinitrobenzamide.
| Compound Name | N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3116207 |
| Molecular Formula | C22H16N4O7 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]-2,4-dinitrobenzamide |
| SMILES | CCOc1ccc(-c2nc3cc(NC(=O)c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])ccc3o2)cc1 |
| InChI | InChI=1S/C22H16N4O7/c1-2-32-16-7-3-13(4-8-16)22-24-18-11-14(5-10-20(18)33-22)23-21(27)17-9-6-15(25(28)29)12-19(17)26(30)31/h3-12H,2H2,1H3,(H,23,27) |
| InChIKey | BVCAJEYIWLRWJR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|