C24H20N4O5S — CID 4502885
N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-methyl-4-nitrobenzamide (PubChem CID 4502885) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 4502885 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-methyl-4-nitrobenzamide |
| SMILES | CCOc1ccc(-c2nc3cc(NC(=S)NC(=O)c4ccc([N+](=O)[O-])c(C)c4)ccc3o2)cc1 |
| InChI | InChI=1S/C24H20N4O5S/c1-3-32-18-8-4-15(5-9-18)23-26-19-13-17(7-11-21(19)33-23)25-24(34)27-22(29)16-6-10-20(28(30)31)14(2)12-16/h4-13H,3H2,1-2H3,(H2,25,27,29,34) |
| InChIKey | GMSSSIXGVVOJFS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|