C25H23N3O4S — CID 1337004
3-ethoxy-N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 1337004) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 3-ethoxy-N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3-ethoxy-N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1337004 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-ethoxy-N-[[2-(4-ethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(-c2nc3cc(NC(=S)NC(=O)c4cccc(OCC)c4)ccc3o2)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-3-30-19-11-8-16(9-12-19)24-27-21-15-18(10-13-22(21)32-24)26-25(33)28-23(29)17-6-5-7-20(14-17)31-4-2/h5-15H,3-4H2,1-2H3,(H2,26,28,29,33) |
| InChIKey | RULRQRYOWWNFKX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|