C24H21ClN4O4 — CID 23095989
2-chloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]-4-nitrobenzamide (PubChem CID 23095989) has the molecular formula C24H21ClN4O4 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23095989 |
| Molecular Formula | C24H21ClN4O4 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-chloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]-4-nitrobenzamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(NC(=O)c4ccc([N+](=O)[O-])cc4Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C24H21ClN4O4/c1-3-28(4-2)17-8-5-15(6-9-17)24-27-21-13-16(7-12-22(21)33-24)26-23(30)19-11-10-18(29(31)32)14-20(19)25/h5-14H,3-4H2,1-2H3,(H,26,30) |
| InChIKey | NOKFBLOHMCTGNQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|