C21H14ClN3O4 — CID 17163184
N-(2-benzyl-1,3-benzoxazol-5-yl)-2-chloro-4-nitrobenzamide (PubChem CID 17163184) has the molecular formula C21H14ClN3O4 and a molecular weight of 407.81 g/mol. Its IUPAC name is N-(2-benzyl-1,3-benzoxazol-5-yl)-2-chloro-4-nitrobenzamide.
| Compound Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 17163184 |
| Molecular Formula | C21H14ClN3O4 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-2-chloro-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc2oc(Cc3ccccc3)nc2c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H14ClN3O4/c22-17-12-15(25(27)28)7-8-16(17)21(26)23-14-6-9-19-18(11-14)24-20(29-19)10-13-4-2-1-3-5-13/h1-9,11-12H,10H2,(H,23,26) |
| InChIKey | SMVDXJQETVOEJQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|