C16H11F3N2O2 — CID 17163179
N-(2-benzyl-1,3-benzoxazol-5-yl)-2,2,2-trifluoroacetamide (PubChem CID 17163179) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is N-(2-benzyl-1,3-benzoxazol-5-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17163179 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc2oc(Cc3ccccc3)nc2c1)C(F)(F)F |
| InChI | InChI=1S/C16H11F3N2O2/c17-16(18,19)15(22)20-11-6-7-13-12(9-11)21-14(23-13)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,20,22) |
| InChIKey | FPGUTEZJOGLWFQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |