C25H17ClN2O3 — CID 17163223
N-(2-benzyl-1,3-benzoxazol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide (PubChem CID 17163223) has the molecular formula C25H17ClN2O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is N-(2-benzyl-1,3-benzoxazol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17163223 |
| Molecular Formula | C25H17ClN2O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-(2-benzyl-1,3-benzoxazol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(Cc3ccccc3)nc2c1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C25H17ClN2O3/c26-19-9-5-4-8-18(19)21-12-13-23(30-21)25(29)27-17-10-11-22-20(15-17)28-24(31-22)14-16-6-2-1-3-7-16/h1-13,15H,14H2,(H,27,29) |
| InChIKey | GHIKGHNKKFOLEA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |