C22H16N4O7 — CID 135814631
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dinitrobenzamide (PubChem CID 135814631) has the molecular formula C22H16N4O7 and a molecular weight of 448.39 g/mol. Its IUPAC name is N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 135814631 |
| Molecular Formula | C22H16N4O7 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dinitrobenzamide |
| SMILES | Cc1cc2nc(-c3cc(NC(=O)c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])ccc3O)oc2cc1C |
| InChI | InChI=1S/C22H16N4O7/c1-11-7-17-20(8-12(11)2)33-22(24-17)16-9-13(3-6-19(16)27)23-21(28)15-5-4-14(25(29)30)10-18(15)26(31)32/h3-10,27H,1-2H3,(H,23,28) |
| InChIKey | LAHSZPNVOUQNLG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|