C15H13N3O6 — CID 5120392
N-(4-hydroxy-2,6-dimethylphenyl)-2,4-dinitrobenzamide (PubChem CID 5120392) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is N-(4-hydroxy-2,6-dimethylphenyl)-2,4-dinitrobenzamide.
| Compound Name | N-(4-hydroxy-2,6-dimethylphenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 5120392 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-(4-hydroxy-2,6-dimethylphenyl)-2,4-dinitrobenzamide |
| SMILES | Cc1cc(O)cc(C)c1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O6/c1-8-5-11(19)6-9(2)14(8)16-15(20)12-4-3-10(17(21)22)7-13(12)18(23)24/h3-7,19H,1-2H3,(H,16,20) |
| InChIKey | NRIWPPBQLNMQDW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|