C14H9F2N3O6 — CID 2315816
N-[4-(difluoromethoxy)phenyl]-2,4-dinitrobenzamide (PubChem CID 2315816) has the molecular formula C14H9F2N3O6 and a molecular weight of 353.24 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 2315816 |
| Molecular Formula | C14H9F2N3O6 |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F2N3O6/c15-14(16)25-10-4-1-8(2-5-10)17-13(20)11-6-3-9(18(21)22)7-12(11)19(23)24/h1-7,14H,(H,17,20) |
| InChIKey | REGJSHLMZPOLMJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|