C20H14F2N2O7S — CID 26800950
[4-[[4-(difluoromethoxy)phenyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 26800950) has the molecular formula C20H14F2N2O7S and a molecular weight of 464.40 g/mol. Its IUPAC name is [4-[[4-(difluoromethoxy)phenyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[[4-(difluoromethoxy)phenyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 26800950 |
| Molecular Formula | C20H14F2N2O7S |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | [4-[[4-(difluoromethoxy)phenyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H14F2N2O7S/c21-20(22)30-16-10-6-14(7-11-16)23-19(25)13-4-8-17(9-5-13)31-32(28,29)18-3-1-2-15(12-18)24(26)27/h1-12,20H,(H,23,25) |
| InChIKey | WHQUBAXDWDOHDC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|