C20H15FN2O6S — CID 55577153
[4-[(3-fluorophenyl)methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 55577153) has the molecular formula C20H15FN2O6S and a molecular weight of 430.41 g/mol. Its IUPAC name is [4-[(3-fluorophenyl)methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[(3-fluorophenyl)methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 55577153 |
| Molecular Formula | C20H15FN2O6S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [4-[(3-fluorophenyl)methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H15FN2O6S/c21-16-4-1-3-14(11-16)13-22-20(24)15-7-9-18(10-8-15)29-30(27,28)19-6-2-5-17(12-19)23(25)26/h1-12H,13H2,(H,22,24) |
| InChIKey | QLRWRRWMDRPNMV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|