C22H17FN2O8S — CID 2670138
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate (PubChem CID 2670138) has the molecular formula C22H17FN2O8S and a molecular weight of 488.45 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2670138 |
| Molecular Formula | C22H17FN2O8S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN2O8S/c23-17-8-4-15(5-9-17)13-24-21(26)14-32-22(27)16-6-10-19(11-7-16)33-34(30,31)20-3-1-2-18(12-20)25(28)29/h1-12H,13-14H2,(H,24,26) |
| InChIKey | YHPRMBBUPMEHBZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|