C21H19FN2O6S — CID 2418521
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2418521) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2418521 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O6S/c22-17-7-3-15(4-8-17)12-23-20(25)14-30-21(26)16-5-9-19(10-6-16)31(27,28)24-13-18-2-1-11-29-18/h1-11,24H,12-14H2,(H,23,25) |
| InChIKey | SHFJQXYMBCOYGN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |