C14H12FNO4 — CID 2714972
[2-(furan-2-ylmethylamino)-2-oxoethyl] 4-fluorobenzoate (PubChem CID 2714972) has the molecular formula C14H12FNO4 and a molecular weight of 277.25 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-fluorobenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2714972 |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1)NCc1ccco1 |
| InChI | InChI=1S/C14H12FNO4/c15-11-5-3-10(4-6-11)14(18)20-9-13(17)16-8-12-2-1-7-19-12/h1-7H,8-9H2,(H,16,17) |
| InChIKey | FEAYZLZEMOGLMN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |