C16H14N2O6 — CID 2504373
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-formylbenzoate (PubChem CID 2504373) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504373 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H14N2O6/c19-9-11-3-5-12(6-4-11)15(21)24-10-14(20)18-16(22)17-8-13-2-1-7-23-13/h1-7,9H,8,10H2,(H2,17,18,20,22) |
| InChIKey | SJQXVFAPICYFML-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|