C15H12Cl2N2O5 — CID 2488908
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 2488908) has the molecular formula C15H12Cl2N2O5 and a molecular weight of 371.18 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2488908 |
| Molecular Formula | C15H12Cl2N2O5 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H12Cl2N2O5/c16-10-4-1-5-11(17)13(10)14(21)24-8-12(20)19-15(22)18-7-9-3-2-6-23-9/h1-6H,7-8H2,(H2,18,19,20,22) |
| InChIKey | QVYPZAYCQPYYFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |