C14H13N3O5 — CID 9413781
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 9413781) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9413781 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H13N3O5/c18-12(9-22-13(19)10-3-1-5-15-7-10)17-14(20)16-8-11-4-2-6-21-11/h1-7H,8-9H2,(H2,16,17,18,20) |
| InChIKey | IFSAMHZXEVYKOV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |