C17H17N3O6 — CID 7949805
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 7949805) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949805 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H17N3O6/c1-11(21)19-13-6-4-12(5-7-13)16(23)26-10-15(22)20-17(24)18-9-14-3-2-8-25-14/h2-8H,9-10H2,1H3,(H,19,21)(H2,18,20,22,24) |
| InChIKey | DQSAHCLEPBHSPS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |