C19H22N2O6 — CID 7984445
butyl 4-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethoxy]benzoate (PubChem CID 7984445) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is butyl 4-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethoxy]benzoate.
| Compound Name | butyl 4-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 7984445 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | butyl 4-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethoxy]benzoate |
| SMILES | CCCCOC(=O)c1ccc(OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H22N2O6/c1-2-3-10-26-18(23)14-6-8-15(9-7-14)27-13-17(22)21-19(24)20-12-16-5-4-11-25-16/h4-9,11H,2-3,10,12-13H2,1H3,(H2,20,21,22,24) |
| InChIKey | KIJABDDBFKYANB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|