C16H15FN2O6 — CID 7791464
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791464) has the molecular formula C16H15FN2O6 and a molecular weight of 350.30 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791464 |
| Molecular Formula | C16H15FN2O6 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(F)cc1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H15FN2O6/c17-11-3-5-12(6-4-11)24-10-15(21)25-9-14(20)19-16(22)18-8-13-2-1-7-23-13/h1-7H,8-10H2,(H2,18,19,20,22) |
| InChIKey | NJSWSSQMYMMEMJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |