C17H18N2O7 — CID 2590459
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate (PubChem CID 2590459) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 2590459 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H18N2O7/c1-23-12-4-6-13(7-5-12)25-11-16(21)26-10-15(20)19-17(22)18-9-14-3-2-8-24-14/h2-8H,9-11H2,1H3,(H2,18,19,20,22) |
| InChIKey | HVHJQLNDCVGZEM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |