C18H20N2O6 — CID 2523204
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate (PubChem CID 2523204) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2523204 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C18H20N2O6/c1-24-14-7-4-13(5-8-14)6-9-17(22)26-12-16(21)20-18(23)19-11-15-3-2-10-25-15/h2-5,7-8,10H,6,9,11-12H2,1H3,(H2,19,20,21,23) |
| InChIKey | BIRGHYFINFJMBI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |