C17H14N2O6 — CID 7193785
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 7193785) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7193785 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2o1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H14N2O6/c20-15(19-17(22)18-9-12-5-3-7-23-12)10-24-16(21)14-8-11-4-1-2-6-13(11)25-14/h1-8H,9-10H2,(H2,18,19,20,22) |
| InChIKey | CHHOKTYOOGWHKY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |