C15H12F2N2O5 — CID 2554865
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2554865) has the molecular formula C15H12F2N2O5 and a molecular weight of 338.27 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2554865 |
| Molecular Formula | C15H12F2N2O5 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H12F2N2O5/c16-9-3-4-11(12(17)6-9)14(21)24-8-13(20)19-15(22)18-7-10-2-1-5-23-10/h1-6H,7-8H2,(H2,18,19,20,22) |
| InChIKey | JYQIEJAKYZXDBW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |