C13H12F2N2O4 — CID 2630450
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2,4-difluorobenzoate (PubChem CID 2630450) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2,4-difluorobenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2630450 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2,4-difluorobenzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H12F2N2O4/c1-2-5-16-13(20)17-11(18)7-21-12(19)9-4-3-8(14)6-10(9)15/h2-4,6H,1,5,7H2,(H2,16,17,18,20) |
| InChIKey | ZOYMBDSTWWISCD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|