C11H12N2O4S — CID 30402187
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] thiophene-3-carboxylate (PubChem CID 30402187) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] thiophene-3-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] thiophene-3-carboxylate |
|---|---|
| PubChem CID | 30402187 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] thiophene-3-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccsc1 |
| InChI | InChI=1S/C11H12N2O4S/c1-2-4-12-11(16)13-9(14)6-17-10(15)8-3-5-18-7-8/h2-3,5,7H,1,4,6H2,(H2,12,13,14,16) |
| InChIKey | ZCVZLLIOEKTRCA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|