C14H14N2O6 — CID 2628699
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2628699) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2628699 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H14N2O6/c1-2-5-15-14(19)16-12(17)7-20-13(18)9-3-4-10-11(6-9)22-8-21-10/h2-4,6H,1,5,7-8H2,(H2,15,16,17,19) |
| InChIKey | KKPWNJGXSSQNCL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|