[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate

C13H15NO5 — CID 2556610

IUPAC[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate
SMILESCC(C)NC(=O)COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-8(2)14-12(15)6-17-13(16)9-3-4-10-11(5-9)19-7-18-10/h3-5,8H,6-7H2,1-2H3,(H,14,15)
InChIKeyOJYBZLIPYUAASV-UHFFFAOYSA-N
MW265.26 g/mol
LogP1.10
Rot. Bonds4

About [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate

[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2556610) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate
PubChem CID2556610
Molecular FormulaC13H15NO5
Molecular Weight265.26 g/mol
Exact Mass265.10
IUPAC Name[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate
SMILESCC(C)NC(=O)COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-8(2)14-12(15)6-17-13(16)9-3-4-10-11(5-9)19-7-18-10/h3-5,8H,6-7H2,1-2H3,(H,14,15)
InChIKeyOJYBZLIPYUAASV-UHFFFAOYSA-N
XLogP1.10
TPSA73.86 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.26
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate?
The IUPAC name of [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate (CID 2556610) is [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate is CC(C)NC(=O)COC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate?
The InChIKey is OJYBZLIPYUAASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c1-8(2)14-12(15)6-17-13(16)9-3-4-10-11(5-9)19-7-18-10/h3-5,8H,6-7H2,1-2H3,(H,14,15).
What are the key properties of [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate?
[2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate has a molecular weight of 265.26 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(propan-2-ylamino)ethyl] 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 2556610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).