[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate

C11H11NO5 — CID 2432731

IUPAC[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate
SMILESCNC(=O)COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C11H11NO5/c1-12-10(13)5-15-11(14)7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H,12,13)
InChIKeyJHAHHGHJSJMLAM-UHFFFAOYSA-N
MW237.21 g/mol
LogP0.32
Rot. Bonds3

About [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate

[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2432731) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate
PubChem CID2432731
Molecular FormulaC11H11NO5
Molecular Weight237.21 g/mol
Exact Mass237.06
IUPAC Name[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate
SMILESCNC(=O)COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C11H11NO5/c1-12-10(13)5-15-11(14)7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H,12,13)
InChIKeyJHAHHGHJSJMLAM-UHFFFAOYSA-N
XLogP0.32
TPSA73.86 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.21
LogP ≤ 50.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate?
The IUPAC name of [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (CID 2432731) is [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate is CNC(=O)COC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate?
The InChIKey is JHAHHGHJSJMLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5/c1-12-10(13)5-15-11(14)7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H,12,13).
What are the key properties of [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate?
[2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate has a molecular weight of 237.21 g/mol, XLogP of 0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 2432731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).