C17H22N2O5 — CID 2635010
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(2-methylpropoxy)benzoate (PubChem CID 2635010) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 2635010 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(2-methylpropoxy)benzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O5/c1-4-9-18-17(22)19-15(20)11-24-16(21)13-5-7-14(8-6-13)23-10-12(2)3/h4-8,12H,1,9-11H2,2-3H3,(H2,18,19,20,22) |
| InChIKey | WSGRNEUQYFAHHK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|