C15H18N2O6S — CID 41238598
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 41238598) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 41238598 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H18N2O6S/c1-3-8-16-15(20)17-13(18)9-23-14(19)12-6-4-11(5-7-12)10-24(2,21)22/h3-7H,1,8-10H2,2H3,(H2,16,17,18,20) |
| InChIKey | VOORZKVWYXBCKT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|