C12H15NO3S — CID 9442194
4-(methylsulfonylmethyl)-N-prop-2-enylbenzamide (PubChem CID 9442194) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-prop-2-enylbenzamide.
| Compound Name | 4-(methylsulfonylmethyl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 9442194 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-3-8-13-12(14)11-6-4-10(5-7-11)9-17(2,15)16/h3-7H,1,8-9H2,2H3,(H,13,14) |
| InChIKey | BJQOWDBHTKGPCH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|