C13H19NO4S — CID 65031706
N-(3-hydroxy-2-methylpropyl)-4-(methylsulfonylmethyl)benzamide (PubChem CID 65031706) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylpropyl)-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(3-hydroxy-2-methylpropyl)-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 65031706 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(3-hydroxy-2-methylpropyl)-4-(methylsulfonylmethyl)benzamide |
| SMILES | CC(CO)CNC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-10(8-15)7-14-13(16)12-5-3-11(4-6-12)9-19(2,17)18/h3-6,10,15H,7-9H2,1-2H3,(H,14,16) |
| InChIKey | PHVLMKCUHQIDEX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |