C19H24N2O3S — CID 51153670
N-[2-(dimethylamino)-2-phenylethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 51153670) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 51153670 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(CS(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-21(2)18(16-7-5-4-6-8-16)13-20-19(22)17-11-9-15(10-12-17)14-25(3,23)24/h4-12,18H,13-14H2,1-3H3,(H,20,22) |
| InChIKey | FEHUKNDYNBCQEP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |