C22H30N4O2 — CID 9369212
N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-[(propan-2-ylcarbamoylamino)methyl]benzamide (PubChem CID 9369212) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-[(propan-2-ylcarbamoylamino)methyl]benzamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 9369212 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)NC[C@@H](c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-16(2)25-22(28)24-14-17-10-12-19(13-11-17)21(27)23-15-20(26(3)4)18-8-6-5-7-9-18/h5-13,16,20H,14-15H2,1-4H3,(H,23,27)(H2,24,25,28)/t20-/m0/s1 |
| InChIKey | LAZJFCJFLABOTF-FQEVSTJZSA-N |
| XLogP | 2.93 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |