C15H18N2O5 — CID 7705365
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(4-methoxyphenyl)acetate (PubChem CID 7705365) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7705365 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(4-methoxyphenyl)acetate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H18N2O5/c1-3-8-16-15(20)17-13(18)10-22-14(19)9-11-4-6-12(21-2)7-5-11/h3-7H,1,8-10H2,2H3,(H2,16,17,18,20) |
| InChIKey | GVGZMEYFNSRBQV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|