C23H21NO4 — CID 8011307
[2-oxo-2-(4-phenylanilino)ethyl] 2-(4-methoxyphenyl)acetate (PubChem CID 8011307) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8011307 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H21NO4/c1-27-21-13-7-17(8-14-21)15-23(26)28-16-22(25)24-20-11-9-19(10-12-20)18-5-3-2-4-6-18/h2-14H,15-16H2,1H3,(H,24,25) |
| InChIKey | NJPSVPHCVVGEOG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |