C23H19F2NO4 — CID 7703768
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 7703768) has the molecular formula C23H19F2NO4 and a molecular weight of 411.40 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 7703768 |
| Molecular Formula | C23H19F2NO4 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(-c2ccccc2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H19F2NO4/c24-23(25)30-20-12-10-19(11-13-20)26-21(27)15-29-22(28)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-13,23H,14-15H2,(H,26,27) |
| InChIKey | OBDPGSWKSFBRCP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |