C19H19F2NO5 — CID 7185737
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-phenoxybutanoate (PubChem CID 7185737) has the molecular formula C19H19F2NO5 and a molecular weight of 379.36 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-phenoxybutanoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 7185737 |
| Molecular Formula | C19H19F2NO5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-phenoxybutanoate |
| SMILES | O=C(COC(=O)CCCOc1ccccc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H19F2NO5/c20-19(21)27-16-10-8-14(9-11-16)22-17(23)13-26-18(24)7-4-12-25-15-5-2-1-3-6-15/h1-3,5-6,8-11,19H,4,7,12-13H2,(H,22,23) |
| InChIKey | PZNRADDBYLKWGP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|