C20H21F2NO5 — CID 7147730
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylphenoxy)butanoate (PubChem CID 7147730) has the molecular formula C20H21F2NO5 and a molecular weight of 393.39 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylphenoxy)butanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7147730 |
| Molecular Formula | C20H21F2NO5 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylphenoxy)butanoate |
| SMILES | Cc1ccc(OCCCC(=O)OCC(=O)Nc2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C20H21F2NO5/c1-14-8-10-15(11-9-14)26-12-4-7-19(25)27-13-18(24)23-16-5-2-3-6-17(16)28-20(21)22/h2-3,5-6,8-11,20H,4,7,12-13H2,1H3,(H,23,24) |
| InChIKey | IKORGQSMPQDOTF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|