C20H19F2NO6 — CID 7855020
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 7855020) has the molecular formula C20H19F2NO6 and a molecular weight of 407.37 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 7855020 |
| Molecular Formula | C20H19F2NO6 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)Nc2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C20H19F2NO6/c1-2-16(24)13-7-9-14(10-8-13)27-12-19(26)28-11-18(25)23-15-5-3-4-6-17(15)29-20(21)22/h3-10,20H,2,11-12H2,1H3,(H,23,25) |
| InChIKey | LUBHXHJCNSRUKI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |