C15H19F2NO4 — CID 7950713
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3,3-dimethylbutanoate (PubChem CID 7950713) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3,3-dimethylbutanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 7950713 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO4/c1-15(2,3)8-13(20)21-9-12(19)18-10-6-4-5-7-11(10)22-14(16)17/h4-7,14H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | HTUJLNVLRZYMKL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |