C22H25F2NO5 — CID 8984705
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-(4-tert-butylphenoxy)propanoate (PubChem CID 8984705) has the molecular formula C22H25F2NO5 and a molecular weight of 421.44 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-(4-tert-butylphenoxy)propanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 8984705 |
| Molecular Formula | C22H25F2NO5 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-(4-tert-butylphenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C(C)(C)C)cc1)C(=O)OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C22H25F2NO5/c1-14(29-16-11-9-15(10-12-16)22(2,3)4)20(27)28-13-19(26)25-17-7-5-6-8-18(17)30-21(23)24/h5-12,14,21H,13H2,1-4H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | ZPAKFOUYIVSWMT-AWEZNQCLSA-N |
| XLogP | 4.53 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |