C22H24N2O4 — CID 8984997
[2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-tert-butylphenoxy)propanoate (PubChem CID 8984997) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-tert-butylphenoxy)propanoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 8984997 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-tert-butylphenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(C(C)(C)C)cc1)C(=O)OCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C22H24N2O4/c1-15(28-18-11-9-17(10-12-18)22(2,3)4)21(26)27-14-20(25)24-19-8-6-5-7-16(19)13-23/h5-12,15H,14H2,1-4H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | SGULFKIXHWZJAC-OAHLLOKOSA-N |
| XLogP | 3.80 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |