C14H15F2NO5 — CID 8613385
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-oxopentanoate (PubChem CID 8613385) has the molecular formula C14H15F2NO5 and a molecular weight of 315.27 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 8613385 |
| Molecular Formula | C14H15F2NO5 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H15F2NO5/c1-9(18)6-7-13(20)21-8-12(19)17-10-4-2-3-5-11(10)22-14(15)16/h2-5,14H,6-8H2,1H3,(H,17,19) |
| InChIKey | SOBMZZOTIIVLDY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |