C19H25F2NO4 — CID 55307493
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-cyclohexylbutanoate (PubChem CID 55307493) has the molecular formula C19H25F2NO4 and a molecular weight of 369.41 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 55307493 |
| Molecular Formula | C19H25F2NO4 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-cyclohexylbutanoate |
| SMILES | O=C(COC(=O)CCCC1CCCCC1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H25F2NO4/c20-19(21)26-16-11-5-4-10-15(16)22-17(23)13-25-18(24)12-6-9-14-7-2-1-3-8-14/h4-5,10-11,14,19H,1-3,6-9,12-13H2,(H,22,23) |
| InChIKey | DGYJSXWRPJBVRY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |