C19H26N2O4 — CID 7554876
[2-(4-carbamoylanilino)-2-oxoethyl] 4-cyclohexylbutanoate (PubChem CID 7554876) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 7554876 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 4-cyclohexylbutanoate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)CCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c20-19(24)15-9-11-16(12-10-15)21-17(22)13-25-18(23)8-4-7-14-5-2-1-3-6-14/h9-12,14H,1-8,13H2,(H2,20,24)(H,21,22) |
| InChIKey | AOGILZFUSHEDOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |